CAS 74635-61-3

Fórmula: C25H36O4

InChI: InChI=1S/C25H36O4/c1-6-15(2)21(26)29-20-10-11-23(4)18(24(20,5)22(27)28)9-12-25-13-16(3)17(14-25)7-8-19(23)25/h6,17-20H,3,7-14H2,1-2,4-5H3,(H,27,28)/b15-6-/t17-,18+,19+,20-,23-,24+,25-/m1/s1

Chave InChI: HCVOJPQEMAKKFV-TXPCZTDQSA-N

SMILES: C/C=C(/C)\C(=O)O[C@@H]1CC[C@]2([C@@H]3CC[C@@H]4C[C@@]3(CC[C@@H]2[C@]1(C)C(=O)O)CC4=C)C

ent-3β-Angeloyloxykaur-16-en-19-oic acid

CAS: 74635-61-3

ent-3Beta-Angeloyloxykaur-16-en-19-oic acid is a natural product of Wedelia, Asteraceae.

Fórmula: C₂₅H₃₆O₄

Pureza: 98%

Cor e Forma: Solid

Peso molecular: 400.559

Ref: TM-TN3948

Ent-3β-angeloyloxykaur-16-en-19-oic acid

CAS: 74635-61-3

Ent-3β-angeloyloxykaur-16-en-19-oic acid is a diterpenoid compound, which is a naturally occurring molecule sourced predominantly from certain plant species. This compound exhibits a distinct mode of action primarily through its anti-inflammatory properties, mediated by influencing key biochemical pathways involved in inflammation. Such pathways may include the modulation of cytokine production and inhibition of specific enzymes or receptors involved in inflammatory responses.

Fórmula: C₂₅H₃₆O₄

Pureza: Min. 95%

Peso molecular: 400.5 g/mol

Ref: 3D-ZCA63561