CAS 771493-42-6

Fórmula: C20H28O5

InChI: InChI=1S/C20H28O5/c1-12-11-16(21)20(3)14(17(22)23)5-4-6-15(20)19(12,2)9-7-13-8-10-25-18(13)24/h5,8,12,15-16,21H,4,6-7,9-11H2,1-3H3,(H,22,23)/t12-,15-,16+,19+,20+/m0/s1

Chave InChI: VIZZFMPBFLWOFS-JUNANHINSA-N

SMILES: C[C@H]1C[C@H]([C@]2([C@H]([C@]1(C)CCC3=CCOC3=O)CCC=C2C(=O)O)C)O

(-)-6β-Hydroxy-5β,8β,9β,10α-cleroda-3,13-dien-16,15-olid-18-oic acid

CAS: 771493-42-6

Fórmula: C₂₀H₂₈O₅

Pureza: 96.0%

Peso molecular: 348.4333

Ref: IN-DA00G8D9

6α-Hydroxycleroda-3,13-dien-16,15-olid-18-oic acid

CAS: 771493-42-6

(-)-6β-Hydroxy-5β,8β,9β,10α-cleroda-3,13-dien-16,15-olid-18-oic acid is one alpha- glucosidase inhibitory constituent from Duranta repens.

Fórmula: C₂₀H₂₈O₅

Pureza: 98%

Cor e Forma: Solid

Peso molecular: 348.43

Ref: TM-TN3197

6α-Hydroxycleroda-3,13-dien-16,15-olid-18-oic acid

CAS: 771493-42-6

Fórmula: C₂₀H₂₈O₅

Pureza: 95%~99%

Cor e Forma: Powder

Peso molecular: 348.439

Ref: BP-SBP02747

6α-Hydroxycleroda-3,13-dien-16,15-olid-18-oic acid

CAS: 771493-42-6

6α-Hydroxycleroda-3,13-dien-16,15-olid-18-oic acid is a diterpenoid lactone, which is isolated from various plants, particularly those belonging to the genus Polyalthia. This compound is characterized by its unique clerodane-type skeleton and is typically found in the leaves or bark of these plants. The biological activity of 6α-Hydroxycleroda-3,13-dien-16,15-olid-18-oic acid arises from its ability to modulate various cellular pathways, including those involved in inflammation, cancer, and microbial resistance. Its mode of action often involves interference with signaling pathways, enzyme inhibition, or interaction with cellular receptors.

Fórmula: C₂₀H₂₈O₅

Pureza: Min. 95%

Peso molecular: 348.4 g/mol

Ref: 3D-WFB49342