CAS 77658-46-9

Fórmula: C20H30O4

InChI: InChI=1S/C20H30O4/c1-17-6-4-7-18(2,16(22)23)13(17)5-8-20-10-11-9-12(14(17)20)24-19(11,3)15(20)21/h11-15,21H,4-10H2,1-3H3,(H,22,23)/t11-,12-,13-,14-,15+,17+,18+,19+,20+/m0/s1

Chave InChI: RNEBMVMFRKVVMY-GOCTUUHOSA-N

SMILES: C[C@@]12CCC[C@@]([C@H]1CC[C@]34[C@H]2[C@@H]5C[C@@H](C3)[C@]([C@H]4O)(O5)C)(C)C(=O)O

ent-11,16-Epoxy-15-hydroxykauran-19-oic acid

CAS: 77658-46-9

Fórmula: C₂₀H₃₀O₄

Pureza: 97.5%

Peso molecular: 334.4498

Ref: IN-DA00G67A

ent-11α,16α-Epoxy-15α-hydroxykauran-19-oic acid

CAS: 77658-46-9

ent-11α,16α-Epoxy-15α-hydroxykauran-19-oic acid is a natural product for research related to life sciences.

Fórmula: C₂₀H₃₀O₄

Pureza: 98%

Cor e Forma: Solid

Peso molecular: 334.456

Ref: TM-TN5584

ent-11α,16α-Epoxy-15α-hydroxykauran-19-oic acid

CAS: 77658-46-9

Fórmula: C₂₀H₃₀O₄

Pureza: 95%~99%

Cor e Forma: Powder

Peso molecular: 334.456

Ref: BP-SBP01962

Ent-11α,16α-epoxy-15α-hydroxykauran-19-oic acid

CAS: 77658-46-9

Ent-11α,16α-epoxy-15α-hydroxykauran-19-oic acid is a diterpenoid compound, which is a secondary metabolite derived from certain plant species, particularly those within the Euphorbiaceae family. This compound is characterized by a complex bicyclic structure that includes an epoxy, hydroxy, and carboxylic acid functional groups, contributing to its unique bioactivity.

Fórmula: C₂₀H₃₀O₄

Pureza: Min. 95%

Peso molecular: 334.4 g/mol

Ref: 3D-CDA65846