CAS 81264-00-8

Fórmula: C20H28O5

InChI: InChI=1S/C20H28O5/c1-11-12-5-8-20(25)18(3)7-4-6-17(2,16(23)24)14(18)13(21)10-19(20,9-12)15(11)22/h12-14,21,25H,1,4-10H2,2-3H3,(H,23,24)/t12-,13-,14-,17-,18-,19-,20-/m1/s1

Chave InChI: UTVJJCFYCUPKOU-DCTHVCBSSA-N

SMILES: C[C@]1(CCC[C@@]2([C@@H]1[C@@H](C[C@]34[C@]2(CC[C@H](C3)C(=C)C4=O)O)O)C)C(=O)O

ent-6,9-Dihydroxy-15-Oxo-16-Kauren-19-Oic Acid

CAS: 81264-00-8

Fórmula: C₂₀H₂₈O₅

Pureza: 96.5%

Peso molecular: 348.4333

Ref: IN-DA00G67E

ent-6,9-Dihydroxy-15-oxo-16-kauren-19-oic acid

CAS: 81264-00-8

ent-6,9-Dihydroxy-15-oxo-16-kauren-19-oic acid is a natural product for research related to life sciences.

Fórmula: C₂₀H₂₈O₅

Pureza: 98%

Cor e Forma: Solid

Peso molecular: 348.439

Ref: TM-TN3953

ent-6α,9α-Dihydroxy-15-oxokaur-16-en-19-oic acid

CAS: 81264-00-8

Fórmula: C₂₀H₂₈O₅

Pureza: 95%~99%

Cor e Forma: Powder

Peso molecular: 348.439

Ref: BP-SBP01164

Ent-6,9-dihydroxy-15-oxo-16-kauren-19-oic acid

CAS: 81264-00-8

Ent-6,9-dihydroxy-15-oxo-16-kauren-19-oic acid is a diterpenoid acid, which is primarily derived from plants belonging to the genus Isodon. It is noted for its unique chemical structure, which contributes to its effectiveness as a biological agent. The mode of action of this compound involves the inhibition of specific pro-inflammatory pathways, making it a significant candidate for research in anti-inflammatory and anti-cancer therapies. Studies have shown that ent-6,9-dihydroxy-15-oxo-16-kauren-19-oic acid can modulate signaling pathways such as NF-κB, thereby reducing the expression of inflammatory cytokines.

Fórmula: C₂₀H₂₈O₅

Pureza: Min. 95%

Peso molecular: 348.4 g/mol

Ref: 3D-GDA26400