CAS 865887-46-3

Fórmula: C16H26O8

InChI: InChI=1S/C16H26O8/c1-16(2,9-5-3-8(4-6-9)14(21)22)24-15-13(20)12(19)11(18)10(7-17)23-15/h3,9-13,15,17-20H,4-7H2,1-2H3,(H,21,22)/t9-,10-,11-,12+,13-,15+/m1/s1

Chave InChI: RQEWNDZNKBUWDH-LREAXHOUSA-N

SMILES: CC(C)([C@H]1CCC(=CC1)C(=O)O)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O

Oleuropeic acid 8-O-glucoside

CAS: 865887-46-3

Fórmula: C₁₆H₂₆O₈

Pureza: 96.0%

Peso molecular: 346.3728

Ref: IN-DA00H3AX

Oleuropeic acid 8-O-glucoside

CAS: 865887-46-3

Oleuropeic acid 8-O-glucoside is a natural product for research related to life sciences. The catalog number is TN4706 and the CAS number is 865887-46-3.

Fórmula: C₁₆H₂₆O₈

Pureza: 98%

Cor e Forma: Solid

Peso molecular: 346.37

Ref: TM-TN4706

Oleuropeic acid 8-O-glucoside

CAS: 865887-46-3

Fórmula: C₁₆H₂₆O₈

Pureza: 95%~99%

Cor e Forma: Powder

Peso molecular: 346.376

Ref: BP-SBP02894

Oleuropeic acid 8-o-glucoside

CAS: 865887-46-3

Oleuropeic acid 8-O-glucoside is a bioactive compound, which is a secoiridoid glycoside derived from the olive tree, Olea europaea. This compound is primarily sourced from the leaves and fruits of olives, where it plays a crucial role in plant defense mechanisms. The mode of action of Oleuropeic acid 8-O-glucoside is largely attributed to its antioxidant and anti-inflammatory properties, which enable it to mitigate oxidative stress and modulate inflammatory pathways.

Fórmula: C₁₆H₂₆O₈

Pureza: Min. 95%

Peso molecular: 346.37 g/mol

Ref: 3D-QJB88746