CAS 880813-36-5

Fórmula: C16H18N2

InChI: InChI=1S/C16H18N2/c1-3-18-15-7-5-4-6-13(15)14-10-12(11-17-2)8-9-16(14)18/h4-10,17H,3,11H2,1-2H3

Chave InChI: LBPNOEAFWYTTEB-UHFFFAOYSA-N

SMILES: CCN1C2=C(C=C(C=C2)CNC)C3=CC=CC=C31

PhiKan 083

CAS: 880813-36-5

PhiKan 083

Fórmula: C₁₆H₁₈N₂

Pureza: ≥98%

Peso molecular: 238.33

Ref: 54-BUP09229

[(9-ethyl-9H-carbazol-3-yl)methyl](methyl)amine

CAS: 880813-36-5

Fórmula: C₁₆H₁₈N₂

Pureza: 97%

Peso molecular: 238.3275

Ref: IN-DA00GXQQ

PhiKan 083

CAS: 880813-36-5

PhiKan 083 is a carbazole derivative

Fórmula: C₁₆H₁₈N₂

Pureza: 98.37%

Cor e Forma: Solid

Peso molecular: 238.3275

Ref: TM-T16523L

PhiKan 083

CAS: 880813-36-5

1-(9-Ethyl-9H-carbazol-3-yl)-N-methylmethanamine

Fórmula: C₁₆H₁₈N₂

Pureza: 99%

Peso molecular: 238.33

Ref: IN-DG01105031

PhiKan 083

CAS: 880813-36-5

PhiKan 083 is a monoclonal antibody that binds to the ubiquitin ligase protein. This protein is involved in the regulation of cellular processes such as transcription and apoptosis. PhiKan 083 has been shown to inhibit the growth of cancer cells, which may be due to its ability to bind to epidermal growth factor receptors (EGFRs) and decrease their expression. Binding of phiKAN 083 to EGFRs also inhibits the synthesis of proteins, leading to cell death.

Fórmula: C₁₆H₁₈N₂

Pureza: Min. 95%

Peso molecular: 238.33 g/mol

Ref: 3D-FKB81336