CAS 955083-90-6

Fórmula: C26H37NO2

InChI: InChI=1S/C26H37NO2/c1-8-17(5)22-18(6)14-26(7)13-16(4)9-10-21(26)23(22)24(28)20-12-19(11-15(2)3)27-25(20)29/h8,11-12,14-16,21-23H,9-10,13H2,1-7H3,(H,27,29)/b17-8+,19-11-/t16-,21+,22-,23+,26+/m1/s1

Chave InChI: TXVWNUBEANXHMB-FXVWVMPXSA-N

SMILES: C/C=C(\C)/[C@H]1[C@H]([C@@H]2CC[C@H](C[C@]2(C=C1C)C)C)C(=O)C3=C/C(=C/C(C)C)/NC3=O

Myceliothermophin E

CAS: 955083-90-6

Fórmula: C₂₆H₃₇NO₂

Pureza: 93.45%

Cor e Forma: White. Solid

Peso molecular: 395.0

Ref: 8R-AD0066

Myceliothermophin E

CAS: 955083-90-6

Myceliothermophin E, from T. thermophilus, is a polyketide-amino acid compound with anticancer and anti-MRSA activities.

Fórmula: C₂₆H₃₇NO₂

Cor e Forma: Solid

Peso molecular: 395.5775

Ref: TM-T35690

Myceliothermophin E

CAS: 955083-90-6

Myceliothermophin E

Cor e Forma: Solid

Peso molecular: 0.00g/mol

Ref: 54-BIBR1133

Myceliothermophin E

CAS: 955083-90-6

Myceliothermophin E is a novel enzyme, which is derived from genetically modified strains of thermophilic fungi. This enzyme operates through a highly efficient catalytic mechanism that specifically targets and degrades fungal hyphae cell walls. The enzymatic action involves hydrolyzing chitin and other polysaccharides, thereby disrupting the structural integrity of fungal cells.

Fórmula: C₂₆H₃₇NO₂

Pureza: Min. 95%

Peso molecular: 395.60 g/mol

Ref: 3D-FNB08390