CAS 956103-75-6

Fórmula: C32H32O6

InChI: InChI=1S/C32H32O6/c1-19-31(36)28(17-23-9-16-29(38-32(19)23)21-5-12-25(34)13-6-21)27(20-3-10-24(33)11-4-20)15-8-22-7-14-26(35)18-30(22)37-2/h3-7,10-14,17-18,27,29,33-36H,8-9,15-16H2,1-2H3/t27?,29-/m1/s1

Chave InChI: ZYNHARKRZSKBAU-ZBAATNBSSA-N

SMILES: CC1=C2C(=CC(=C1O)C(CCC3=C(C=C(C=C3)O)OC)C4=CC=C(C=C4)O)CC[C@@H](O2)C5=CC=C(C=C5)O

(2R)-8-Methylsocotrin-4'-ol

CAS: 956103-75-6

(2R)-8-Methylsocotrin-4'-ol is a complex organic compound, which is a synthetic derivative, engineered for extensive research in biochemical and pharmacological studies. This compound is primarily sourced through advanced synthetic organic chemistry techniques, allowing for precise control of its stereo- and regio-chemical properties. Its mode of action involves interacting with specific biological receptors, potentially acting as an agonist or antagonist, depending on its molecular target. This interaction may induce a cascade of biochemical events that can be leveraged for therapeutic outcomes.

Fórmula: C₃₂H₃₂O₆

Pureza: Min. 95%

Peso molecular: 512.60 g/mol

Ref: 3D-GNB10375