CAS 97232-96-7

Fórmula: C20H22N4O10S

InChI: InChI=1S/C20H22N4O10S/c1-9(25)33-10(2)34-19(28)15-11(7-32-20(21)29)8-35-18-14(17(27)24(15)18)22-16(26)13(23-30-3)12-5-4-6-31-12/h4-6,10,14,18H,7-8H2,1-3H3,(H2,21,29)(H,22,26)/b23-13+/t10?,14-,18-/m1/s1

Chave InChI: KEJCWVGMRLCZQQ-DJMWJSSGSA-N

SMILES: CC(OC(=O)C)OC(=O)C1=C(CS[C@H]2N1C(=O)[C@H]2NC(=O)/C(=N/OC)/C3=CC=CO3)COC(=O)N

Cefuroxime Axetil E-isomers

CAS: 97232-96-7

Nucleic acids and their salts, whether or not chemically defined; other heterocyclic compounds, nesoi

Fórmula: C₂₀H₂₂N₄O₁₀S

Cor e Forma: Pale Yellow Powder

Peso molecular: 510.10566

Ref: 45-1098253

Cefuroxime axetil EP impurity B

CAS: 97232-96-7

Cefuroxime axetil EP impurity B

Fórmula: C₂₀H₂₆N₄O₁₀S

Pureza: 98%

Peso molecular: 514.51

Ref: 54-OR1158480

Cefuroxime Axetil EP Impurity B (Mixture of Diastereomers)

CAS: 97232-96-7

Fórmula: C₂₀H₂₂N₄O₁₀S

Peso molecular: 510.47

Ref: 4Z-C-445003

Cefuroxime Axetil EP Impurity B

CAS: 97232-96-7

Fórmula: C₂₀H₂₂N₄O₁₀S

Peso molecular: 510.47

Ref: ST-EA-CP-C92002

Cefuroxime axetil EP impurity B

CAS: 97232-96-7

Fórmula: C₂₀H₂₂N₄O₁₀S

Pureza: 98%

Peso molecular: 510.4745

Ref: IN-DA01V27M