CAS 97399-71-8

Fórmula: C19H18O4

InChI: InChI=1S/C19H18O4/c1-9-8-23-18-11-4-6-12-10(5-7-13(20)19(12,2)3)15(11)17(22)16(21)14(9)18/h4,6,8,13,20H,5,7H2,1-3H3/t13-/m1/s1

Chave InChI: PTDUBPDLRWKSBQ-CYBMUJFWSA-N

SMILES: CC1=COC2=C1C(=O)C(=O)C3=C2C=CC4=C3CC[C@H](C4(C)C)O

3α-Hydroxytanshinone IIA

CAS: 97399-71-8

3α-Hydroxytanshinone IIA

Peso molecular: 310.12

Ref: 10-F565686

(R)-7-Hydroxy-1,6,6-trimethyl-6,7,8,9-tetrahydrophenanthro[1,2-b]furan-10,11-dione

CAS: 97399-71-8

(R)-7-Hydroxy-1,6,6-trimethyl-6,7,8,9-tetrahydrophenanthro[1,2-b]furan-10,11-dione

Fórmula: C₁₉H₁₈O₄

Pureza: 98%

Peso molecular: 310.34

Ref: 54-OR1112451

3α-Hydroxytanshinone IIA

CAS: 97399-71-8

3α-Hydroxytanshinone IIA (Compound 5), an isolatable compound from the roots of Salvia miltiorrhiza ^[1], exhibits specific characteristics.

Fórmula: C₁₉H₁₈O₄

Cor e Forma: Solid

Peso molecular: 310.3438

Ref: TM-TN7368

(R)-7-Hydroxy-1,6,6-trimethyl-6,7,8,9-tetrahydrophenanthro[1,2-b]furan-10,11-dione

CAS: 97399-71-8

Fórmula: C₁₉H₁₈O₄

Pureza: 98%

Cor e Forma: Solid

Peso molecular: 310.3438

Ref: IN-DA01WTYA

3Alpha-Hydroxytanshinone IIA

CAS: 97399-71-8

3Alpha-Hydroxytanshinone IIA is a bioactive compound derived from Salvia miltiorrhiza, a plant commonly known as Danshen. This compound is characterized as a diterpenoid, which boasts a diverse range of biological activities. As an active constituent of this traditional medicinal herb, 3Alpha-Hydroxytanshinone IIA exerts its effects primarily through the modulation of oxidative stress pathways and various signaling cascades involved in inflammation and apoptosis.

Fórmula: C₁₉H₁₈O₄

Pureza: Min. 95%

Peso molecular: 310.30 g/mol

Ref: 3D-XDA39971