CAS 99911-94-1

Fórmula: C14H11NO4

InChI: InChI=1S/C14H11NO4/c16-13(18-11-7-3-1-4-8-11)15-14(17)19-12-9-5-2-6-10-12/h1-10H,(H,15,16,17)

Chave InChI: FOXXAQRNEIMDEC-UHFFFAOYSA-N

SMILES: C1=CC=C(C=C1)OC(=O)NC(=O)OC2=CC=CC=C2

Diphenyl imidodicarboxylate

CAS: 99911-94-1

Diphenyl imidodicarboxylate

Fórmula: C₁₄H₁₁NO₄

Pureza: ≥95%

Peso molecular: 257.24144

Ref: 54-OR310619

Diphenyl imidodicarboxylate

CAS: 99911-94-1

Diphenyl imidodicarboxylate is a versatile compound with various applications. It is commonly used as a research chemical and has antiviral properties, making it suitable for the development of new antiviral drugs. Diphenyl imidodicarboxylate is also used in the synthesis of polyketides, which are important compounds in pharmaceuticals and natural products. Additionally, it can be utilized as an acetal or fatty acid derivative in the production of nanoemulsion compositions. Its unique chemical structure allows for the incorporation of different functional groups such as propionate, nitro, amines, ethylmalonyl-coa, 2-hydroxyisobutyric acid, hydrogen bonds, glycan, and polyvinyl. With its wide range of applications and potential uses, diphenyl imidodicarboxylate is a valuable compound in the field of chemistry and drug development.

Fórmula: C₁₄H₁₁NO₄

Pureza: Min. 95%

Peso molecular: 257.24 g/mol

Ref: 3D-ZDA91194

phenyl N-(phenoxycarbonyl)carbamate

CAS: 99911-94-1

Fórmula: C₁₄H₁₁NO₄

Pureza: 95%

Cor e Forma: Solid

Peso molecular: 257.2414

Ref: IN-DA00IKCU