Informação sobre produto
Nome:(S)-HPMPA
Sinónimos:
- (S)-9-[3-Hydroxy-2-(phosphonylmethoxy)propyl]adenine
Marca:Biosynth
Descrição:(S)-HPMPA is a nucleotide analogue, which is a chemically synthesized compound designed to mimic nucleotides. It acts as both an antiviral and an antitumor agent, sourced primarily through synthetic chemistry involving the modification of naturally occurring nucleotide structures. The mode of action of (S)-HPMPA involves mimicking natural substrates of various viral polymerases and cellular enzymes, thereby inhibiting viral DNA synthesis and disrupting the replication cycle of DNA viruses. Additionally, it can interfere with certain cellular pathways contributing to its antitumor effects.
Aviso:Os nossos productos estão destinados exclusivamente para uso em laboratório. Para qualquer outra aplicação, por favor entre em contacto.
Propriedades químicas
Peso molecular:303.21 g/mol
Fórmula:C9H14N5O5P
Pureza:Min. 95%
InChI:InChI=1S/C9H14N5O5P/c10-8-7-9(12-3-11-8)14(4-13-7)1-6(2-15)19-5-20(16,17)18/h3-4,6,15H,1-2,5H2,(H2,10,11,12)(H2,16,17,18)/t6-/m0/s1
Chave InChI:InChIKey=FRPXSOOHWNMLPH-LURJTMIESA-N
SMILES:Nc1ncnc2c1ncn2C[C@@H](CO)OCP(=O)(O)O
Consulta técnica sobre (S)-HPMPA
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda
Por favor, utilize o carrinho para solicitar um orçamento ou uma encomenda. Se desejar solicitar um orçamento ou fazer uma encomenda, por favor, adicione os produtos ao seu carrinho e depois solicite um orçamento ou encomenda a partir do carrinho. É mais rápido, mais barato e poderá beneficiar-se dos descontos e outras vantagens disponíveis.