CAS 100-32-3
:Bis(4-nitrophenyl) disulfide
Description:
Bis(4-nitrophenyl) disulfide, with the CAS number 100-32-3, is an organic compound characterized by its disulfide linkage and two 4-nitrophenyl groups. It appears as a yellow crystalline solid, indicative of its aromatic structure and the presence of nitro groups, which contribute to its color and reactivity. The compound is relatively stable under standard conditions but can undergo reduction reactions, particularly in the presence of reducing agents, leading to the formation of thiols. Its solubility is generally limited in non-polar solvents, while it may exhibit some solubility in polar organic solvents. Bis(4-nitrophenyl) disulfide is often utilized in organic synthesis and as a reagent in various chemical reactions, including those involving thiol-disulfide exchange. Additionally, due to the presence of nitro groups, it may exhibit some degree of biological activity, making it of interest in medicinal chemistry and materials science. Safety precautions should be taken when handling this compound, as it may pose health risks upon exposure.
Formula:C12H8N2O4S2
InChI:InChI=1S/C12H8N2O4S2/c15-13(16)9-1-5-11(6-2-9)19-20-12-7-3-10(4-8-12)14(17)18/h1-8H
InChI key:InChIKey=KWGZRLZJBLEVFZ-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=CC=C(SSC2=CC=C(N(=O)=O)C=C2)C=C1
Synonyms:- 1,1'-Disulfanediylbis(4-Nitrobenzene)
- 1,1′-Dithiobis(4-Nitrobenzene)
- 1,2-Bis(4-nitrophenyl)disulfane
- 1-Nitro-4-[(4-nitrophenyl)disulfanyl]benzene
- 4,4-Dinitro diphenyl disulfide
- Bis(4-nitrophenyl) disulfide
- Bis(p-nitrophenyl) disulfide
- Di(4-nitrophenyl) disulfide
- Di(p-nitrophenyl) disulfide
- Disulfide, bis(4-nitrophenyl)
- Disulfide, bis(p-nitrophenyl)
- NSC 4566
- NSC 677446
- p,p′-Dinitrodiphenyl disulfide
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Bis(4-nitrophenyl) Disulfide
CAS:Formula:C12H8N2O4S2Purity:>97.0%(GC)Color and Shape:White to Yellow powder to crystalMolecular weight:308.334,4'-Dinitrodiphenyl disulfide
CAS:Formula:C12H8N2O4S2Purity:98%Color and Shape:SolidMolecular weight:308.3329Bis(4-nitrophenyl) disulphide
CAS:<p>Bis(4-nitrophenyl) disulphide</p>Formula:C12H8N2O4S2Purity:99%Color and Shape: pale yellow solidMolecular weight:308.33g/mol1-Nitro-4-[(4-nitrophenyl)dithio]benzene
CAS:Formula:C12H8N2O4S2Purity:95%Color and Shape:Solid, Yellow to tan powderMolecular weight:308.334,4'-Dinitro diphenyl disulfide
CAS:<p>4,4'-Dinitro diphenyl disulfide is a molecule that has been shown to induce apoptosis in cells. It has been shown to have antibacterial activity against a number of Gram-positive and Gram-negative bacteria. The mechanism of action of 4,4'-Dinitro diphenyl disulfide is not yet clear but there are several theories as to how it may work. One theory is that the molecule can react with chloride ions on the bacterial cell surface, which leads to the formation of hydrogen chloride gas. This gas interacts with nitric oxide or hydroxyl radicals, leading to the activation of the molecule's antifungal properties. Another theory is that 4,4'-Dinitro diphenyl disulfide binds to the metal surface and penetrates through pores in the cell wall, where it reacts with molecules such as nitro groups or chlorides present inside the cell. The reaction between these molecules leads to an increase in cellular hydrogen ions</p>Purity:Min. 95%




