CAS 100-87-8
:Benzenemethanesulfonic acid
Description:
Benzenemethanesulfonic acid, also known as benzylsulfonic acid, is an aromatic sulfonic acid characterized by the presence of a benzyl group attached to a sulfonic acid functional group. Its molecular structure features a benzene ring bonded to a methanesulfonic acid moiety, which contributes to its acidic properties. This compound is typically a white to light yellow solid and is soluble in water, making it useful in various applications. It exhibits strong acidity, which allows it to act as a proton donor in chemical reactions. Benzenemethanesulfonic acid is often utilized as a reagent in organic synthesis, particularly in the preparation of sulfonamides and other sulfonic acid derivatives. Additionally, it can serve as a catalyst in certain reactions due to its ability to stabilize carbocations. Safety precautions should be taken when handling this substance, as it can be corrosive and may cause irritation to skin and eyes. Proper storage in a cool, dry place is recommended to maintain its stability.
Formula:C7H8O3S
InChI:InChI=1S/C7H8O3S/c8-11(9,10)6-7-4-2-1-3-5-7/h1-5H,6H2,(H,8,9,10)
InChI key:InChIKey=NIXKBAZVOQAHGC-UHFFFAOYSA-N
SMILES:C(S(=O)(=O)O)C1=CC=CC=C1
Synonyms:- α-Toluenesulfonic acid
- Benzylsulfonic acid
- Benzyl-α-sulfonic acid
- Benzenemethanesulfonic acid
- Phenylmethanesulfonic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
