
CAS 1000-00-6: 1,1,3,3-Tetraethyl-1,3-dimethyldisiloxane
Description:1,1,3,3-Tetraethyl-1,3-dimethyldisiloxane is a siloxane compound characterized by its unique structure, which includes two silicon atoms connected by oxygen atoms, with various alkyl groups attached. This compound typically exhibits low volatility and high thermal stability, making it suitable for applications in various industrial processes, including as a lubricant or in silicone formulations. Its molecular structure contributes to its hydrophobic properties, allowing it to repel water and resist moisture. Additionally, it may possess good dielectric properties, which can be advantageous in electronic applications. The presence of multiple ethyl and methyl groups enhances its compatibility with organic solvents and other materials. Safety data indicates that, like many siloxanes, it should be handled with care, as it may cause irritation upon contact with skin or eyes. Overall, 1,1,3,3-Tetraethyl-1,3-dimethyldisiloxane is valued for its chemical stability and versatility in various applications, particularly in the fields of materials science and chemical engineering.
Formula:C10H26OSi2
InChI:InChI=1S/C10H26OSi2/c1-7-12(5,8-2)11-13(6,9-3)10-4/h7-10H2,1-6H3
InChI key:InChIKey=ILYAQWBKAVFRGF-UHFFFAOYSA-N
SMILES:O([Si](C)(CC)CC)[Si](C)(CC)CC
- Synonyms:
- Bis(diethylmethylsilyl) ether
- Disiloxane, 1,1,3,3-tetraethyl-1,3-dimethyl-
- 1,1,3,3-Tetraethyl-1,3-dimethyldisiloxane
- 1,3-Dimethyltetraethyldisiloxane
- NSC 96852
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Disiloxane, 1,1,3,3-tetraethyl-1,3-dimethyl- REF: IN-DA00007NCAS: 1000-00-6 | - - - | To inquire | Wed 05 Mar 25 |
![]() | 1,1,3,3-Tetraethyl-1,3-dimethyldisiloxane REF: 10-F636309CAS: 1000-00-6 | 98% | - - - | Discontinued product |
![]() | 1,1,3,3-Tetraethyl-1,3-dimethyldisiloxane REF: 3D-BAA00000CAS: 1000-00-6 | Min. 95% | - - - | Discontinued product |

Disiloxane, 1,1,3,3-tetraethyl-1,3-dimethyl-
Ref: IN-DA00007N
Undefined size | To inquire |

Ref: 10-F636309
25g | Discontinued | Request information | |
100g | Discontinued | Request information |

1,1,3,3-Tetraethyl-1,3-dimethyldisiloxane
Ref: 3D-BAA00000
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information | |
50g | Discontinued | Request information |