CAS 1000-78-8
:N1,N6-Bis(2,2-dimethylpropylidene)-1,6-hexanediamine
Description:
N1,N6-Bis(2,2-dimethylpropylidene)-1,6-hexanediamine, with the CAS number 1000-78-8, is a chemical compound characterized by its unique structure, which includes two 2,2-dimethylpropylidene groups attached to a hexanediamine backbone. This compound is typically classified as an amine due to the presence of amino groups in its structure. It exhibits properties such as being a viscous liquid or solid at room temperature, depending on its specific formulation and purity. The presence of multiple alkyl groups contributes to its hydrophobic characteristics, making it less soluble in water but more soluble in organic solvents. This compound is often utilized in various industrial applications, including as a curing agent in epoxy resins and as an intermediate in the synthesis of other chemical products. Its reactivity is influenced by the amino groups, which can participate in various chemical reactions, including condensation and substitution reactions. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance.
Formula:C16H32N2
InChI:InChI=1S/C16H32N2/c1-15(2,3)13-17-11-9-7-8-10-12-18-14-16(4,5)6/h13-14H,7-12H2,1-6H3
InChI key:InChIKey=ZFYXJSOEGJUVCC-UHFFFAOYSA-N
SMILES:C(C(C)(C)C)=NCCCCCCN=CC(C)(C)C
Synonyms:- 1,6-Hexanediamine, N,N′-bis(2,2-dimethylpropylidene)-
- 1,6-Hexanediamine, N1,N6-bis(2,2-dimethylpropylidene)-
- N,N′-Bis(2,2-dimethylpropylidene)-1,6-hexanediamine
- 1,6-Hexanediamine, N,N′-dineopentylidene-
- N1,N6-Bis(2,2-dimethylpropylidene)-1,6-hexanediamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
