
CAS 1000-91-5
:Dimethyl(1-methylethoxy)silane
Description:
Dimethyl(1-methylethoxy)silane, with the CAS number 1000-91-5, is an organosilicon compound characterized by the presence of a silicon atom bonded to two methyl groups and one 1-methylethoxy group. This compound typically appears as a colorless liquid and is known for its low viscosity and moderate volatility. It exhibits properties common to silanes, such as reactivity with moisture, which can lead to the formation of siloxane networks upon hydrolysis. Dimethyl(1-methylethoxy)silane is often utilized in the synthesis of silicone polymers and as a coupling agent in various applications, including coatings, adhesives, and sealants. Its structure allows for compatibility with organic materials, enhancing adhesion and durability in composite materials. Additionally, it may serve as an intermediate in the production of other silane derivatives. Safety considerations include handling it in well-ventilated areas and using appropriate personal protective equipment, as it may cause irritation upon contact with skin or eyes.
Formula:C5H14OSi
InChI:InChI=1S/C5H14OSi/c1-5(2)6-7(3)4/h5,7H,1-4H3
InChI key:InChIKey=OARYFQYHTWCNQO-UHFFFAOYSA-N
SMILES:O(C(C)C)[SiH](C)C
Synonyms:- Dimethyl(1-methylethoxy)silane
- Silane, isopropoxydimethyl-
- Isopropoxydimethylsilane
- Silane, dimethyl(1-methylethoxy)-
- Dimethylisopropoxysilane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
