CymitQuimica logo

CAS 10000-20-1

:

1,2-bis[tert-butyl(dimethyl)silyl]hydrazine

Description:
1,2-bis[tert-butyl(dimethyl)silyl]hydrazine is a chemical compound characterized by its unique structure, which includes two tert-butyl(dimethyl)silyl groups attached to a hydrazine backbone. This compound is typically used in organic synthesis and may serve as a precursor or intermediate in the preparation of various silicon-containing materials. Its molecular structure contributes to its properties, such as relatively low volatility and potential stability under certain conditions. The presence of the tert-butyl groups enhances steric hindrance, which can influence reactivity and solubility in organic solvents. Additionally, the dimethylsilyl groups provide a degree of hydrophobicity, making the compound less polar. Safety considerations should be taken into account when handling this substance, as hydrazines are known to be toxic and potentially hazardous. Overall, 1,2-bis[tert-butyl(dimethyl)silyl]hydrazine is a specialized compound with applications in chemical research and materials science, reflecting the versatility of organosilicon chemistry.
Formula:C12H32N2Si2
InChI:InChI=1/C12H32N2Si2/c1-11(2,3)15(7,8)13-14-16(9,10)12(4,5)6/h13-14H,1-10H3
SMILES:CC(C)(C)[Si](C)(C)NN[Si](C)(C)C(C)(C)C
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.