CAS 1000007-16-8: 4-Bromo-3-(methylthio)quinoline
Description:4-Bromo-3-(methylthio)quinoline is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a bromine atom at the 4-position and a methylthio group at the 3-position contributes to its unique chemical properties. This compound typically exhibits moderate solubility in organic solvents, reflecting its aromatic nature. It may participate in various chemical reactions, including electrophilic substitution due to the electron-withdrawing effects of the bromine atom and the electron-donating properties of the methylthio group. The compound's structure suggests potential biological activity, making it of interest in medicinal chemistry and drug development. Additionally, its synthesis may involve standard organic reactions such as halogenation and thiomethylation. Safety data should be consulted, as halogenated compounds can pose health risks, and appropriate handling procedures should be followed in laboratory settings. Overall, 4-Bromo-3-(methylthio)quinoline is a noteworthy compound in the field of organic chemistry with potential applications in various research areas.
Formula:C10H8BrNS
InChI:InChI=1S/C10H8BrNS/c1-13-9-6-12-8-5-3-2-4-7(8)10(9)11/h2-6H,1H3
InChI key:InChIKey=GFNRGNHUYPUAGU-UHFFFAOYSA-N
SMILES:BrC=1C(SC)=CN=C2C=CC=CC21
- Synonyms:
- 4-Bromo-3-(methylthio)quinoline
- Quinoline, 4-bromo-3-(methylthio)-
