CymitQuimica logo

CAS 1000017-92-4

:

3,5-dibromo-2-chloro-4-methylpyridine

Description:
3,5-Dibromo-2-chloro-4-methylpyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of two bromine atoms at the 3 and 5 positions, along with a chlorine atom at the 2 position and a methyl group at the 4 position, contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit a pale yellow to brown color. It is known for its potential applications in pharmaceuticals, agrochemicals, and as an intermediate in organic synthesis. The halogen substituents can enhance its reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the presence of the methyl group can influence its solubility and polarity. Safety data should be consulted, as halogenated compounds can pose environmental and health risks. Overall, 3,5-dibromo-2-chloro-4-methylpyridine is a versatile compound with significant relevance in chemical research and industry.
Formula:C6H4Br2ClN
InChI:InChI=1/C6H4Br2ClN/c1-3-4(7)2-10-6(9)5(3)8/h2H,1H3
InChI key:PFKZKCIYLRBYBZ-UHFFFAOYSA-N
SMILES:Cc1c(cnc(c1Br)Cl)Br
Synonyms:
  • 2-Chloro-3,5-dibromo-4-methylpyridine
  • Pyridine, 3,5-Dibromo-2-Chloro-4-Methyl-
Found 3 products.