CymitQuimica logo

CAS 1000017-97-9

:

Ethyl5-aminoimidazo[1,2-a]pyridine-2-carboxylate

Description:
Ethyl 5-aminoimidazo[1,2-a]pyridine-2-carboxylate is a chemical compound characterized by its imidazo-pyridine structure, which features a fused ring system that includes both imidazole and pyridine moieties. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and solubility in organic solvents. The presence of an amino group and an ethyl ester functional group suggests that it may participate in various chemical reactions, including nucleophilic substitutions and esterifications. Its molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry and drug development. The compound's CAS number, 1000017-97-9, is a unique identifier that facilitates its identification in chemical databases. Overall, Ethyl 5-aminoimidazo[1,2-a]pyridine-2-carboxylate is a versatile compound with potential applications in pharmaceuticals and research, particularly in the study of its biological activities and synthesis pathways.
Formula:C10H11N3O2
InChI:InChI=1S/C10H11N3O2/c1-2-15-10(14)7-6-13-8(11)4-3-5-9(13)12-7/h3-6H,2,11H2,1H3
InChI key:SDHJUHBOHSJBEH-UHFFFAOYSA-N
SMILES:CCOC(=O)C1=CN2C(=N1)C=CC=C2N
Found 2 products.