CAS 1000018-05-2: 4-Nitro-2-propylbenzoxazole
Description:4-Nitro-2-propylbenzoxazole is an organic compound characterized by its benzoxazole structure, which consists of a fused benzene and oxazole ring. The presence of a nitro group at the 4-position and a propyl group at the 2-position contributes to its unique chemical properties. This compound is typically a yellow to orange solid and is known for its potential applications in various fields, including materials science and organic electronics, due to its photophysical properties. It may exhibit fluorescence, making it useful in dye applications. The nitro group can also influence its reactivity, potentially participating in electrophilic substitution reactions. Additionally, the compound's solubility can vary depending on the solvent, which is an important consideration for its application in different chemical environments. Safety data should be reviewed, as nitro compounds can be hazardous, and appropriate handling and storage conditions are essential. Overall, 4-Nitro-2-propylbenzoxazole is a compound of interest in both research and industrial applications.
Formula:C10H10N2O3
InChI:InChI=1S/C10H10N2O3/c1-2-4-9-11-10-7(12(13)14)5-3-6-8(10)15-9/h3,5-6H,2,4H2,1H3
InChI key:InChIKey=RFNYHMIDCHJYAU-UHFFFAOYSA-N
SMILES:O=N(=O)C=1C=CC=C2OC(=NC21)CCC
- Synonyms:
- Benzoxazole, 4-nitro-2-propyl-
- 4-Nitro-2-propylbenzoxazole
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 4-Nitro-2-propyl-1,3-benzoxazole REF: 54-OR01984CAS: 1000018-05-2 | - - - | 211.00 € | Tue 04 Mar 25 |
![]() | 4-Nitro-2-propyl-1,3-benzoxazole REF: 10-F068808CAS: 1000018-05-2 | 97.0% | - - - | Discontinued product |
![]() | 4-Nitro-2-propyl-1,3-benzoxazole REF: 3D-AQB01805CAS: 1000018-05-2 | Min. 95% | - - - | Discontinued product |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
Ref: 10-F068808
1g | Discontinued | Request information |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
4-Nitro-2-propyl-1,3-benzoxazole
Ref: 3D-AQB01805
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information | |
500mg | Discontinued | Request information |