CymitQuimica logo

CAS 1000018-17-6

:

1-[2,4-Bis(methylsulfonyl)phenyl]piperazine

Description:
1-[2,4-Bis(methylsulfonyl)phenyl]piperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The compound features a phenyl group substituted at the 2 and 4 positions with methylsulfonyl groups, which are known for their sulfonyl functional group (-SO2-) attached to a methyl group. This structure contributes to its potential biological activity, as the piperazine moiety is often found in various pharmacologically active compounds. The presence of the methylsulfonyl groups may enhance solubility and influence the compound's interaction with biological targets. The compound is typically a solid at room temperature and may exhibit moderate to high stability under standard conditions. Its properties, such as solubility, melting point, and reactivity, can vary based on the specific conditions and the presence of other substances. Due to its unique structure, it may be of interest in medicinal chemistry and drug development, particularly in the context of neuropharmacology or as a potential therapeutic agent.
Formula:C12H18N2O4S2
InChI:InChI=1S/C12H18N2O4S2/c1-19(15,16)10-3-4-11(12(9-10)20(2,17)18)14-7-5-13-6-8-14/h3-4,9,13H,5-8H2,1-2H3
InChI key:InChIKey=RQHNMARLZQGRBN-UHFFFAOYSA-N
SMILES:S(C)(=O)(=O)C1=C(C=CC(S(C)(=O)=O)=C1)N2CCNCC2
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.