CAS 1000018-20-1

5-Chloro-6-oxo-4-[4-[(phenylmethoxy)carbonyl]-1-piperazinyl]-1(6H)-pyridazineacetic acid

Description:

5-Chloro-6-oxo-4-[4-[(phenylmethoxy)carbonyl]-1-piperazinyl]-1(6H)-pyridazineacetic acid is a synthetic organic compound characterized by its complex structure, which includes a pyridazine ring, a piperazine moiety, and a chloro substituent. The presence of the chloro group contributes to its reactivity and potential biological activity. The compound features an acetic acid functional group, which may influence its solubility and interaction with biological systems. The phenylmethoxycarbonyl group enhances its lipophilicity, potentially affecting its pharmacokinetic properties. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its specific applications and efficacy would depend on further studies, including in vitro and in vivo evaluations. As with many synthetic compounds, safety and toxicity assessments are crucial for determining its suitability for therapeutic use. Overall, this compound represents a class of molecules that could have significant implications in pharmaceutical research.

Formula: C₁₈H₁₉ClN₄O₅

InChI: InChI=1S/C18H19ClN4O5/c19-16-14(10-20-23(17(16)26)11-15(24)25)21-6-8-22(9-7-21)18(27)28-12-13-4-2-1-3-5-13/h1-5,10H,6-9,11-12H2,(H,24,25)

InChI key: InChIKey=QELQPUOINUEWPT-UHFFFAOYSA-N

SMILES: ClC1=C(C=NN(CC(O)=O)C1=O)N2CCN(C(OCC3=CC=CC=C3)=O)CC2

Synonyms:

• 1(6H)-Pyridazineacetic acid, 5-chloro-6-oxo-4-[4-[(phenylmethoxy)carbonyl]-1-piperazinyl]-
• 5-Chloro-6-oxo-4-[4-[(phenylmethoxy)carbonyl]-1-piperazinyl]-1(6H)-pyridazineacetic acid

[4-Piperazin-1-yl-5-chloro-6-oxo-6H-pyridazin-1-yl]acetic acid, N4-CBZ protected

CAS: 1000018-20-1

[4-Piperazin-1-yl-5-chloro-6-oxo-6H-pyridazin-1-yl]acetic acid, N4-CBZ protected

Purity: 95%

Molecular weight: 406.82g/mol

Ref: 54-OR15475