CymitQuimica logo

CAS 1000018-25-6

:

Ethyl 1-[[[(1,1-dimethylethoxy)carbonyl]amino]sulfonyl]-4-piperidinecarboxylate

Description:
Ethyl 1-[[[(1,1-dimethylethoxy)carbonyl]amino]sulfonyl]-4-piperidinecarboxylate, with CAS number 1000018-25-6, is a chemical compound characterized by its complex structure, which includes a piperidine ring, an ethyl ester group, and a sulfonamide functionality. This compound is typically a white to off-white solid, exhibiting moderate solubility in organic solvents and limited solubility in water, which is common for many piperidine derivatives. The presence of the sulfonyl group contributes to its potential biological activity, making it of interest in medicinal chemistry. Its molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and acylation, due to the reactive functional groups present. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, this compound's unique characteristics make it a subject of interest for further research, particularly in the fields of pharmaceuticals and organic synthesis.
Formula:C13H24N2O6S
InChI:InChI=1S/C13H24N2O6S/c1-5-20-11(16)10-6-8-15(9-7-10)22(18,19)14-12(17)21-13(2,3)4/h10H,5-9H2,1-4H3,(H,14,17)
InChI key:InChIKey=HWLHFRDIBQJGNI-UHFFFAOYSA-N
SMILES:S(NC(OC(C)(C)C)=O)(=O)(=O)N1CCC(C(OCC)=O)CC1
Synonyms:
  • Ethyl 1-[[[(1,1-dimethylethoxy)carbonyl]amino]sulfonyl]-4-piperidinecarboxylate
  • 4-Piperidinecarboxylic acid, 1-[[[(1,1-dimethylethoxy)carbonyl]amino]sulfonyl]-, ethyl ester
Sort by
Found 2 products.