CAS 1000018-35-8
:1-[5-Bromo-2-methyl-4-(methylsulfonyl)phenyl]piperazine
Description:
1-[5-Bromo-2-methyl-4-(methylsulfonyl)phenyl]piperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The compound features a bromine atom and a methylsulfonyl group attached to a phenyl ring, contributing to its unique chemical properties. The presence of the bromine substituent enhances its reactivity and potential for forming various derivatives, while the methylsulfonyl group can influence solubility and polarity. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its structure suggests potential interactions with biological targets, possibly influencing neurotransmitter systems or other pathways. The molecular weight, solubility, and specific reactivity would depend on the overall structure and substituents, which can affect its behavior in different environments. As with many piperazine derivatives, it may also be explored for its therapeutic applications, particularly in the development of pharmaceuticals. Safety and handling precautions should be observed due to the presence of bromine and other functional groups.
Formula:C12H17BrN2O2S
InChI:InChI=1S/C12H17BrN2O2S/c1-9-7-12(18(2,16)17)10(13)8-11(9)15-5-3-14-4-6-15/h7-8,14H,3-6H2,1-2H3
InChI key:InChIKey=LQGLNCQPMBCRAE-UHFFFAOYSA-N
SMILES:CC1=C(C=C(Br)C(S(C)(=O)=O)=C1)N2CCNCC2
Synonyms:- 1-[5-Bromo-2-methyl-4-(methylsulfonyl)phenyl]piperazine
- Piperazine, 1-[5-bromo-2-methyl-4-(methylsulfonyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.