CymitQuimica logo

CAS 1000018-39-2

:

3-(3-Methyl-1-piperidinyl)-4-(methylsulfonyl)benzenamine

Description:
3-(3-Methyl-1-piperidinyl)-4-(methylsulfonyl)benzenamine, identified by its CAS number 1000018-39-2, is a chemical compound that features a piperidine ring substituted with a methyl group and a sulfonyl group attached to a benzene ring. This compound is characterized by its amine functional group, which contributes to its basicity and potential reactivity. The presence of the methylsulfonyl group enhances its solubility in polar solvents and may influence its biological activity. The piperidine moiety is known for its role in various pharmacological applications, often contributing to the compound's ability to interact with biological targets. Overall, this compound may exhibit properties relevant to medicinal chemistry, including potential use in drug development, due to its structural features that allow for diverse interactions within biological systems. Its specific characteristics, such as melting point, boiling point, and spectral data, would require further investigation through experimental methods or literature sources.
Formula:C13H20N2O2S
InChI:InChI=1S/C13H20N2O2S/c1-10-4-3-7-15(9-10)12-8-11(14)5-6-13(12)18(2,16)17/h5-6,8,10H,3-4,7,9,14H2,1-2H3
InChI key:InChIKey=CFXUFCWEYPFZRN-UHFFFAOYSA-N
SMILES:S(C)(=O)(=O)C1=C(C=C(N)C=C1)N2CC(C)CCC2
Synonyms:
  • 3-(3-Methyl-1-piperidinyl)-4-(methylsulfonyl)benzenamine
  • Benzenamine, 3-(3-methyl-1-piperidinyl)-4-(methylsulfonyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.