CAS 1000018-40-5
:4-(Methylsulfonyl)-3-(1-pyrrolidinyl)benzenamine
Description:
4-(Methylsulfonyl)-3-(1-pyrrolidinyl)benzenamine, identified by its CAS number 1000018-40-5, is an organic compound characterized by the presence of a methylsulfonyl group and a pyrrolidinyl substituent attached to a benzene ring. This compound typically exhibits properties associated with aromatic amines, including potential solubility in polar solvents due to the presence of the sulfonyl group. The pyrrolidinyl moiety may contribute to its basicity and potential interactions with biological systems, making it of interest in medicinal chemistry. The compound's structure suggests it may participate in hydrogen bonding and other intermolecular interactions, influencing its reactivity and stability. Additionally, the presence of the methylsulfonyl group can enhance its metabolic stability and influence its pharmacokinetic properties. Overall, this compound's unique functional groups and structural features make it a candidate for various applications, including drug development and chemical synthesis. However, specific safety and handling guidelines should be followed due to the potential toxicity associated with aromatic amines.
Formula:C11H16N2O2S
InChI:InChI=1S/C11H16N2O2S/c1-16(14,15)11-5-4-9(12)8-10(11)13-6-2-3-7-13/h4-5,8H,2-3,6-7,12H2,1H3
InChI key:InChIKey=AMMYEUZBQIIWPL-UHFFFAOYSA-N
SMILES:S(C)(=O)(=O)C1=C(C=C(N)C=C1)N2CCCC2
Synonyms:- 4-(Methylsulfonyl)-3-(1-pyrrolidinyl)benzenamine
- Benzenamine, 4-(methylsulfonyl)-3-(1-pyrrolidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-Methanesulfonyl-3-pyrrolidinoaniline
CAS:Controlled ProductFormula:C11H16N2O2SColor and Shape:NeatMolecular weight:240.32
