
CAS 1000018-42-7
:1-[2-Methoxy-6-(methylsulfonyl)phenyl]piperazine
Description:
1-[2-Methoxy-6-(methylsulfonyl)phenyl]piperazine, with the CAS number 1000018-42-7, is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a methoxy group and a methylsulfonyl group attached to a phenyl ring, contributing to its unique chemical properties. The presence of the methoxy group enhances its solubility in organic solvents, while the methylsulfonyl group may influence its biological activity and interactions with various receptors or enzymes. The compound is likely to exhibit polar characteristics due to the functional groups, which can affect its pharmacokinetics and bioavailability. Additionally, the structural arrangement suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychiatric conditions, given the piperazine moiety's prevalence in such drug classes. Overall, this compound's specific characteristics make it a subject of interest in both synthetic and medicinal chemistry research.
Formula:C12H18N2O3S
InChI:InChI=1S/C12H18N2O3S/c1-17-10-4-3-5-11(18(2,15)16)12(10)14-8-6-13-7-9-14/h3-5,13H,6-9H2,1-2H3
InChI key:InChIKey=IUJWLYYUUWSKMF-UHFFFAOYSA-N
SMILES:S(C)(=O)(=O)C1=C(C(OC)=CC=C1)N2CCNCC2
Synonyms:- 1-[2-Methoxy-6-(methylsulfonyl)phenyl]piperazine
- Piperazine, 1-[2-methoxy-6-(methylsulfonyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.