
CAS 1000027-16-6
:1,1-Dimethylethyl N-[(3S,4R)-3-methoxy-4-piperidinyl]carbamate
Description:
1,1-Dimethylethyl N-[(3S,4R)-3-methoxy-4-piperidinyl]carbamate, with the CAS number 1000027-16-6, is a chemical compound characterized by its unique structural features, including a carbamate functional group and a piperidine ring. This compound typically exhibits moderate to high solubility in organic solvents, while its solubility in water may vary depending on the specific conditions. The presence of the methoxy group contributes to its potential for hydrogen bonding, influencing its reactivity and interaction with biological systems. As a carbamate, it may exhibit properties related to inhibition of certain enzymes or receptors, making it of interest in medicinal chemistry and pharmacology. The stereochemistry indicated by the (3S,4R) configuration suggests that the compound may have specific biological activity, as stereoisomers can exhibit different pharmacological effects. Overall, this compound's characteristics make it a subject of interest for further research in drug development and chemical synthesis.
Formula:C11H22N2O3
InChI:InChI=1S/C11H22N2O3/c1-11(2,3)16-10(14)13-8-5-6-12-7-9(8)15-4/h8-9,12H,5-7H2,1-4H3,(H,13,14)/t8-,9+/m1/s1
InChI key:InChIKey=BSSCFNOPCQQJAZ-BDAKNGLRSA-N
SMILES:N(C(OC(C)(C)C)=O)[C@H]1[C@@H](OC)CNCC1
Synonyms:- Carbamic acid, N-[(3S,4R)-3-methoxy-4-piperidinyl]-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl N-[(3S,4R)-3-methoxy-4-piperidinyl]carbamate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.