CymitQuimica logo

CAS 100003-85-8

:

7-(Chloromethyl)-3-(4-chlorophenyl)-5H-thiazolo[3,2-a]pyrimidin-5-one

Description:
7-(Chloromethyl)-3-(4-chlorophenyl)-5H-thiazolo[3,2-a]pyrimidin-5-one is a heterocyclic compound characterized by its thiazole and pyrimidine rings, which contribute to its biological activity and potential pharmacological properties. The presence of chloromethyl and chlorophenyl groups enhances its reactivity and may influence its interaction with biological targets. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many heterocycles. Its structure suggests potential applications in medicinal chemistry, particularly in the development of antimicrobial or anticancer agents, as thiazole and pyrimidine derivatives are often explored for such purposes. The compound's unique arrangement of functional groups may also impart specific electronic and steric characteristics, affecting its binding affinity and selectivity towards various biological receptors. As with many synthetic compounds, safety and handling precautions should be observed due to the presence of chlorine substituents, which can pose health risks. Further studies would be necessary to fully elucidate its biological activity and potential therapeutic applications.
Formula:C13H8Cl2N2OS
InChI:InChI=1S/C13H8Cl2N2OS/c14-6-10-5-12(18)17-11(7-19-13(17)16-10)8-1-3-9(15)4-2-8/h1-5,7H,6H2
InChI key:InChIKey=YGUARRHCBSLHCR-UHFFFAOYSA-N
SMILES:O=C1N2C(=CSC2=NC(CCl)=C1)C3=CC=C(Cl)C=C3
Synonyms:
  • 7-(Chloromethyl)-3-(4-chlorophenyl)-5H-thiazolo[3,2-a]pyrimidin-5-one
  • 5H-Thiazolo[3,2-a]pyrimidin-5-one, 7-(chloromethyl)-3-(4-chlorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.