CAS 100004-93-1

2-(1-Naphthalenyl)-4-pyridinecarboxylic acid

Description:

2-(1-Naphthalenyl)-4-pyridinecarboxylic acid, also known by its CAS number 100004-93-1, is an organic compound characterized by its unique structure that combines a naphthalene moiety with a pyridinecarboxylic acid functional group. This compound typically exhibits a solid state at room temperature and is soluble in organic solvents, reflecting its aromatic nature. The presence of both the naphthalene and pyridine rings contributes to its potential as a ligand in coordination chemistry, as well as its utility in various organic synthesis applications. The carboxylic acid group imparts acidic properties, allowing for potential interactions in biological systems or catalysis. Additionally, the compound may exhibit interesting photophysical properties due to the conjugated system formed by the aromatic rings, making it a candidate for studies in materials science or medicinal chemistry. Its reactivity and stability can be influenced by the substituents on the aromatic rings, which can affect its behavior in different chemical environments.

Formula: C₁₆H₁₁NO₂

InChI: InChI=1S/C16H11NO2/c18-16(19)12-8-9-17-15(10-12)14-7-3-5-11-4-1-2-6-13(11)14/h1-10H,(H,18,19)

InChI key: InChIKey=GISKBORJJFIVKW-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C(C=2C3=C(C=CC2)C=CC=C3)N=CC1

Synonyms:

• 4-Pyridinecarboxylic acid, 2-(1-naphthalenyl)-
• 2-(Naphthalen-1-yl)-isonicotinic acid
• 2-(1-Naphthalenyl)-4-pyridinecarboxylic acid

2-(Naphthalen-1-yl)isonicotinic acid

CAS: 100004-93-1

Formula: C₁₆H₁₁NO₂

Molecular weight: 249.2640

Ref: IN-DA0000A2