CAS 100004-95-3
:2-(3-Methoxyphenyl)-4-pyridinecarboxylic acid
Description:
2-(3-Methoxyphenyl)-4-pyridinecarboxylic acid, with the CAS number 100004-95-3, is an organic compound characterized by its aromatic and heterocyclic structure. It features a pyridine ring, which is a six-membered ring containing one nitrogen atom, and a carboxylic acid functional group (-COOH) that contributes to its acidity and potential reactivity. The presence of a methoxy group (-OCH3) on the phenyl ring enhances its lipophilicity and may influence its biological activity. This compound is typically used in pharmaceutical research and development due to its potential as a building block for various medicinal compounds. Its solubility properties can vary depending on the solvent, and it may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's structure suggests potential for hydrogen bonding and other intermolecular interactions, which can affect its physical properties and reactivity. Overall, 2-(3-Methoxyphenyl)-4-pyridinecarboxylic acid is a versatile compound with applications in various fields of chemistry and pharmacology.
Formula:C13H11NO3
InChI:InChI=1S/C13H11NO3/c1-17-11-4-2-3-9(7-11)12-8-10(13(15)16)5-6-14-12/h2-8H,1H3,(H,15,16)
InChI key:InChIKey=CVHWXPCBLBMQDT-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(N=CC1)C2=CC(OC)=CC=C2
Synonyms:- 2-(3-Methoxyphenyl)-4-pyridinecarboxylic acid
- 2-(3-Methoxyphenyl)isonicotinic acid
- 4-Pyridinecarboxylic acid, 2-(3-methoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
