
CAS 1000068-66-5
:1-(1,1-Dimethylethyl) 2-borono-7-methyl-1H-indole-1-carboxylate
Description:
1-(1,1-Dimethylethyl) 2-borono-7-methyl-1H-indole-1-carboxylate, with the CAS number 1000068-66-5, is a chemical compound that features a boron atom bonded to an indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound is characterized by the presence of a tert-butyl group (1,1-dimethylethyl) and a carboxylate functional group, which contributes to its reactivity and solubility properties. The boron atom in the structure is typically involved in coordination chemistry, making this compound potentially useful in various applications, including organic synthesis and medicinal chemistry. The indole moiety is known for its biological significance, often serving as a scaffold in pharmaceuticals. The compound's stability, solubility, and reactivity can be influenced by the substituents on the indole ring and the boron atom, making it a subject of interest in both academic and industrial research settings.
Formula:C14H18BNO4
InChI:InChI=1S/C14H18BNO4/c1-9-6-5-7-10-8-11(15(18)19)16(12(9)10)13(17)20-14(2,3)4/h5-8,18-19H,1-4H3
InChI key:InChIKey=XKVDBDOIYHSBCS-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1C=2C(C=C1B(O)O)=CC=CC2C
Synonyms:- 1H-Indole-1-carboxylic acid, 2-borono-7-methyl-, 1-(1,1-dimethylethyl) ester
- 1-(1,1-Dimethylethyl) 2-borono-7-methyl-1H-indole-1-carboxylate
Sort by
Found 0 products.

