CAS 100012-45-1: ir-1051
Description:Ir-1051, identified by its CAS number 100012-45-1, is a chemical compound that is not widely recognized in mainstream chemical databases or literature, suggesting it may be a specialized or proprietary substance. Typically, compounds with such identifiers may be used in niche applications, possibly in research or industrial settings. Characteristics of a chemical substance generally include its molecular structure, physical state (solid, liquid, or gas), solubility, reactivity, and potential applications. For a specific compound like Ir-1051, one would typically examine its spectral data, toxicity, stability under various conditions, and interactions with other chemicals. If it is a novel or less common compound, detailed information may be available through specialized publications or proprietary research. For accurate and comprehensive data, consulting a chemical database or contacting the manufacturer or researcher associated with the compound would be advisable.
Formula:C41H33BCl2F4N2
InChI:InChI=1/C41H33Cl2N2.BF4/c1-3-44-35(31-14-8-12-29-33(42)20-24-37(44)40(29)31)22-18-27-16-17-28(39(27)26-10-6-5-7-11-26)19-23-36-32-15-9-13-30-34(43)21-25-38(41(30)32)45(36)4-2;2-1(3,4)5/h5-15,18-25H,3-4,16-17H2,1-2H3;/q+1;-1
- Synonyms:
- 6-chloro-2-(2(3((6-chloro-1-ethylbenz*(C,D)indole
- 6-chloro-2-[(E)-2-{(3E)-3-[(2E)-2-(6-chloro-1-ethylbenzo[cd]indol-2(1H)-ylidene)ethylidene]-2-phenylcyclopent-1-en-1-yl}ethenyl]-1-ethylbenzo[cd]indolium tetrafluoroborate

Benz[cd]indolium, 6-chloro-2-[2-[3-[2-(6-chloro-1-ethylbenz[cd]indol-2(1H)-ylidene)ethylidene]-2-phenyl-1-cyclopenten-1-yl]ethenyl]-1-ethyl-, tetrafluoroborate(1-) (1:1)
Ref: IN-DA0000AH
Undefined size | To inquire |

6-Chloro-2-[2-(3-[(6-chloro-1-ethylbenz[c,d,]indole-2[1H]-ylidene)ethylidene]-2-phenyl-1-cyclopenten-1-yl)ethenyl]-1-ethylbenz[c,d]i ndolium tetrafluoroborate
Ref: 3D-FC104137
25mg | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information |