
CAS 1000166-63-1
:N-[2-(7-Bromo-8,9-dihydro-5-oxo-9-pentyl-5H-1,2,4-triazolo[4,3-a]purin-3-yl)ethyl]-2-methyl-4-pyridinecarboxamide
Description:
N-[2-(7-Bromo-8,9-dihydro-5-oxo-9-pentyl-5H-1,2,4-triazolo[4,3-a]purin-3-yl)ethyl]-2-methyl-4-pyridinecarboxamide is a complex organic compound characterized by its unique structural features, including a triazolo-purine core and a pyridinecarboxamide moiety. The presence of a bromine atom and a pentyl group contributes to its hydrophobic characteristics, which may influence its solubility and biological activity. This compound is likely to exhibit specific interactions with biological targets, potentially serving as a pharmacophore in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in areas related to nucleic acid interactions or enzyme inhibition. The compound's synthesis and characterization would typically involve advanced organic chemistry techniques, including chromatography and spectroscopy, to confirm its purity and structural integrity. Additionally, the compound's safety and efficacy would need to be evaluated through rigorous biological testing, considering its potential therapeutic applications. Overall, this substance represents a significant interest in the field of pharmaceutical chemistry due to its intricate design and possible biological implications.
Formula:C20H23BrN8O2
InChI:InChI=1S/C20H23BrN8O2/c1-3-4-5-10-28-16-15(24-19(21)25-16)18(31)29-14(26-27-20(28)29)7-9-23-17(30)13-6-8-22-12(2)11-13/h6,8,11H,3-5,7,9-10H2,1-2H3,(H,23,30)(H,24,25)
InChI key:InChIKey=DVTXVXBFUKVHBK-UHFFFAOYSA-N
SMILES:C(CCCC)N1C=2N(C(CCNC(=O)C=3C=C(C)N=CC3)=NN2)C(=O)C4=C1N=C(Br)N4
Synonyms:- 4-Pyridinecarboxamide, N-[2-(7-bromo-8,9-dihydro-5-oxo-9-pentyl-5H-1,2,4-triazolo[4,3-a]purin-3-yl)ethyl]-2-methyl-
- N-[2-(7-Bromo-8,9-dihydro-5-oxo-9-pentyl-5H-1,2,4-triazolo[4,3-a]purin-3-yl)ethyl]-2-methyl-4-pyridinecarboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-Pyridinecarboxamide, N-[2-(7-bromo-8,9-dihydro-5-oxo-9-pentyl-5H-1,2,4-triazolo[4,3-a]purin-3-yl)ethyl]-2-methyl-
CAS:Formula:C20H23BrN8O2Molecular weight:487.353
