CAS 100021-79-2

Hexadecanoic acid, compd. with 1,2-ethanediamine (1:1)

Description:

Hexadecanoic acid, also known as palmitic acid, is a saturated fatty acid with a long carbon chain, typically consisting of 16 carbon atoms. When it forms a compound with 1,2-ethanediamine in a 1:1 molar ratio, it results in a complex that exhibits both hydrophobic and hydrophilic characteristics due to the presence of the fatty acid and the amine. This compound is likely to have applications in various fields, including biochemistry and materials science, due to its potential role in forming surfactants or emulsifiers. The presence of the amine can enhance solubility in polar solvents and may influence the compound's behavior in biological systems. Additionally, the structure may exhibit interesting thermal and phase transition properties, making it relevant for studies in lipid chemistry and drug delivery systems. Overall, this compound combines the properties of a fatty acid with those of an amine, leading to unique characteristics that can be exploited in various applications.

Formula: C₁₆H₃₂O₂·C₂H₈N₂

InChI: InChI=1S/C16H32O2.C2H8N2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;3-1-2-4/h2-15H2,1H3,(H,17,18);1-4H2

InChI key: InChIKey=ITWATCMIPRAPEE-UHFFFAOYSA-N

SMILES: C(CN)N.C(CCCCCCCCCC)CCCCC(O)=O

Synonyms:

• Hexadecanoic acid, compd. with 1,2-ethanediamine (1:1)
• (2-Aminoethyl)ammonium palmitate
• 1,2-Ethanediamine, monohexadecanoate

Hexadecanoic acid, compd. with 1,2-ethanediamine (1:1)

CAS: 100021-79-2

Formula: C₁₈H₄₀N₂O₂

Molecular weight: 316.5224

Ref: IN-DA0000B2