
CAS 100021-80-5
:9-Octadecenamide, N-(2-aminoethyl)-, (Z)-, phosphate
Description:
9-Octadecenamide, N-(2-aminoethyl)-, (Z)-, phosphate, commonly referred to as a phospholipid derivative, is characterized by its long hydrocarbon chain and the presence of both an amide and a phosphate functional group. This compound features a cis double bond in the octadecene chain, which contributes to its fluidity and potential biological activity. The aminoethyl group enhances its solubility in polar solvents, making it relevant in various biochemical applications. As a phospholipid, it plays a crucial role in membrane structure and function, influencing cell signaling and interactions. Its amphiphilic nature allows it to form micelles or bilayers in aqueous environments, which is essential for drug delivery systems and nanotechnology. Additionally, the presence of the phosphate group can facilitate interactions with other biomolecules, making it a subject of interest in research related to cell membranes and lipid metabolism. Overall, this compound's unique structural features contribute to its significance in both biological and industrial contexts.
Formula:C20H40N2O·xH3O4P
InChI:InChI=1S/C20H40N2O.H3O4P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(23)22-19-18-21;1-5(2,3)4/h9-10H,2-8,11-19,21H2,1H3,(H,22,23);(H3,1,2,3,4)/b10-9-;
InChI key:InChIKey=UMIWJUPRWKLHSD-KVVVOXFISA-N
SMILES:C(CCCCC/C=C\CCCCCCCC)CC(NCCN)=O.P(=O)(O)(O)O
Synonyms:- (2-Aminoethyl)oleoylammonium dihydrogen phosphate
- 9-Octadecenamide, N-(2-aminoethyl)-, (Z)-, phosphate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
9-Octadecenamide, N-(2-aminoethyl)-, (Z)-, phosphate (9CI)
CAS:Formula:C20H43N2O5PMolecular weight:422.5396
