CAS 100021-82-7
:Hexadecanamide, N-(2-aminoethyl)-, phosphate
Description:
Hexadecanamide, N-(2-aminoethyl)-, phosphate, also known by its CAS number 100021-82-7, is an organic compound characterized by its long hydrophobic hydrocarbon chain and a polar phosphate group. This substance features a hexadecanamide backbone, which contributes to its amphiphilic nature, allowing it to interact with both hydrophobic and hydrophilic environments. The presence of the aminoethyl group enhances its solubility in aqueous solutions, making it useful in various biochemical applications. Hexadecanamide derivatives are often studied for their potential roles in drug delivery systems, surfactants, and as emulsifying agents due to their ability to stabilize interfaces. Additionally, the phosphate moiety can participate in biochemical interactions, making this compound relevant in the fields of biochemistry and molecular biology. Its properties, such as melting point, solubility, and reactivity, can vary based on the specific conditions and formulations in which it is used. Overall, this compound exemplifies the intersection of organic chemistry and biochemistry, with applications that leverage its unique structural features.
Formula:C18H38N2O·xH3O4P
InChI:InChI=1S/C18H38N2O.H3O4P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18(21)20-17-16-19;1-5(2,3)4/h2-17,19H2,1H3,(H,20,21);(H3,1,2,3,4)
InChI key:InChIKey=XORGSWPUTFUITJ-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCCCCC)CC(NCCN)=O.P(=O)(O)(O)O
Synonyms:- Hexadecanamide, N-(2-aminoethyl)-, phosphate
- N-(2-Aminoethyl)palmitamide phosphate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
