CAS 100021-84-9
:Octadecanoic acid, compd. with 1,2-ethanediamine phosphate
Description:
Octadecanoic acid, also known as stearic acid, is a long-chain saturated fatty acid with a straight-chain structure consisting of 18 carbon atoms. When it forms a compound with 1,2-ethanediamine phosphate, it typically exhibits characteristics associated with both the fatty acid and the amine phosphate. This compound may display amphiphilic properties, allowing it to interact with both hydrophobic and hydrophilic environments, which is useful in various applications such as emulsifiers, surfactants, and in drug delivery systems. The presence of the phosphate group can enhance solubility in polar solvents and may impart biological activity, making it relevant in biochemical contexts. Additionally, the compound may exhibit stability under a range of pH conditions, and its melting point is influenced by the long hydrocarbon chain of the octadecanoic acid. Overall, this compound is of interest in fields such as materials science, pharmaceuticals, and biochemistry due to its unique structural and functional properties.
Formula:C18H36O2·xC2H8N2·xH3O4P
InChI:InChI=1S/C18H36O2.C2H8N2.H3O4P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;3-1-2-4;1-5(2,3)4/h2-17H2,1H3,(H,19,20);1-4H2;(H3,1,2,3,4)
InChI key:InChIKey=YVVCEMHZXXJLOI-UHFFFAOYSA-N
SMILES:P(=O)(O)(O)O.C(CN)N.C(CCCCCCCCCCC)CCCCCC(O)=O
Synonyms:- 1,2-Ethanediamine, octadecanoate phosphate
- Stearic acid compd. with ethane-1,2-diamine phosphate
- Octadecanoic acid, compd. with 1,2-ethanediamine phosphate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
