CymitQuimica logo

CAS 10003-69-7

:

2,2′,2′′,2′′′-[1,2-Ethanediylidenetetrakis(thio)]tetrakis[acetic acid]

Description:
The chemical substance known as "2,2′,2′′,2′′′-[1,2-Ethanediylidenetetrakis(thio)]tetrakis[acetic acid]" with CAS number 10003-69-7 is a complex organic compound characterized by its tetrakis structure, which indicates the presence of four acetic acid groups linked through a central ethanediylidenetetrakis(thio) moiety. This compound features multiple thiol (-SH) groups, contributing to its potential reactivity and ability to form metal complexes. It is typically soluble in polar solvents due to the presence of carboxylic acid functional groups, which can ionize in aqueous solutions. The compound may exhibit chelating properties, making it useful in coordination chemistry and potential applications in biochemistry, such as in drug delivery or as a ligand in metal ion capture. Its structural complexity and functional groups suggest it could participate in various chemical reactions, including esterification and thiol-disulfide exchange. Overall, this compound's unique characteristics make it of interest in both synthetic and applied chemistry contexts.
Formula:C10H14O8S4
InChI:InChI=1S/C10H14O8S4/c11-5(12)1-19-9(20-2-6(13)14)10(21-3-7(15)16)22-4-8(17)18/h9-10H,1-4H2,(H,11,12)(H,13,14)(H,15,16)(H,17,18)
InChI key:InChIKey=AWLPPBSWOMXWGA-UHFFFAOYSA-N
SMILES:C(C(SCC(O)=O)SCC(O)=O)(SCC(O)=O)SCC(O)=O
Synonyms:
  • Acetic acid, 2,2′,2′′,2′′′-[1,2-ethanediylidenetetrakis(thio)]tetrakis-
  • 2,2′,2′′,2′′′-[1,2-Ethanediylidenetetrakis(thio)]tetrakis[acetic acid]
  • 1,1,2,2-Tetrakis(carboxymethylthio)ethane
  • Acetic acid, (ethanediylidenetetrathio)tetra-
  • Ethylidenetetrathiotetraacetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.