CAS 10003-94-8
:uridine 5'-tetraphosphate
Description:
Uridine 5'-tetraphosphate, also known as Up4A, is a nucleotide derivative characterized by its structure, which consists of a uridine base linked to a tetraphosphate chain. It plays a significant role in cellular signaling and is involved in various biochemical processes, including energy transfer and the regulation of enzyme activity. Up4A is known for its ability to activate purinergic receptors, which are crucial for mediating cellular responses to extracellular signals. This compound is typically found in the cytoplasm of cells and can influence processes such as vasodilation and neurotransmission. Its stability and reactivity are influenced by the presence of phosphate groups, which can undergo hydrolysis under physiological conditions. Additionally, uridine 5'-tetraphosphate can serve as a substrate for various kinases and phosphatases, further highlighting its importance in metabolic pathways. Overall, Up4A is a vital molecule in the realm of biochemistry, contributing to the intricate network of cellular communication and metabolic regulation.
Formula:C9H16N2O18P4
InChI:InChI=1/C9H16N2O18P4/c12-5-1-2-11(9(15)10-5)8-7(14)6(13)4(26-8)3-25-31(19,20)28-33(23,24)29-32(21,22)27-30(16,17)18/h1-2,4,6-8,13-14H,3H2,(H,19,20)(H,21,22)(H,23,24)(H,10,12,15)(H2,16,17,18)/t4-,6-,7-,8-/m1/s1
SMILES:c1cn([C@H]2[C@@H]([C@@H]([C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)O)O)c(=O)nc1O
Synonyms:- Uridine 5'-(pentahydrogen tetraphosphate)
- 5'-O-{hydroxy[(hydroxy{[hydroxy(phosphonooxy)phosphoryl]oxy}phosphoryl)oxy]phosphoryl}uridine
- Uridine 5'-tetraphosphate
- Diquafosol Impurity 8
- DISCONTINUED. Please see U830060.
- (5-(2,4-dioxo-3,4-dihydropyrimidin
- Diquafoso
- Diquafosol Impurity 6(UP4)
- Uridine5'-(pentahydrogen tetraphosphate) (9CI)
- -Tetraphosphate
- 5'-O-{Hydroxy[(hydroxy{[hydroxy(phosphonooxy)phosphoryl]oxy}phosp horyl)oxy]phosphoryl}uridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
