CymitQuimica logo

CAS 1000339-28-5

:

3-(2-Bromophenyl)-5-(2-chlorophenyl)-1,2,4-oxadiazole

Description:
3-(2-Bromophenyl)-5-(2-chlorophenyl)-1,2,4-oxadiazole is an organic compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. This compound features two aromatic substituents: a bromophenyl group and a chlorophenyl group, which contribute to its chemical properties and potential reactivity. The presence of halogen atoms (bromine and chlorine) enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry and material science. The oxadiazole moiety is known for its applications in pharmaceuticals, agrochemicals, and as a building block in organic synthesis. The compound may exhibit interesting electronic properties due to the conjugation between the aromatic rings and the heterocyclic system, potentially leading to applications in organic electronics or photonics. Its stability, solubility, and reactivity can vary based on the specific conditions and solvents used in experiments or applications.
Formula:C14H8BrClN2O
InChI:InChI=1S/C14H8BrClN2O/c15-11-7-3-1-5-9(11)13-17-14(19-18-13)10-6-2-4-8-12(10)16/h1-8H
InChI key:InChIKey=QXTCOSGKUMUJDY-UHFFFAOYSA-N
SMILES:BrC1=C(C=CC=C1)C=2N=C(ON2)C3=C(Cl)C=CC=C3
Synonyms:
  • 3-(2-Bromophenyl)-5-(2-chlorophenyl)-1,2,4-oxadiazole
  • 1,2,4-Oxadiazole, 3-(2-bromophenyl)-5-(2-chlorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.