CAS 1000339-30-9: 2-Chloro-6-(1-pyrrolidinyl)pyrazine
Description:2-Chloro-6-(1-pyrrolidinyl)pyrazine is a heterocyclic organic compound characterized by the presence of a pyrazine ring, which is a six-membered aromatic ring containing two nitrogen atoms at non-adjacent positions. The compound features a chlorine substituent at the 2-position and a pyrrolidine group at the 6-position, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on its form, and is soluble in organic solvents. The presence of the pyrrolidine moiety may impart basic characteristics, making it potentially reactive in various chemical reactions, including nucleophilic substitutions. This compound is of interest in medicinal chemistry and may exhibit biological activity, making it a candidate for further research in drug development. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks. Overall, 2-Chloro-6-(1-pyrrolidinyl)pyrazine is a versatile compound with applications in synthetic chemistry and pharmacology.
Formula:C8H10ClN3
InChI:InChI=1S/C8H10ClN3/c9-7-5-10-6-8(11-7)12-3-1-2-4-12/h5-6H,1-4H2
InChI key:InChIKey=JWMYNAAPKTUCSM-UHFFFAOYSA-N
SMILES:ClC=1N=C(C=NC1)N2CCCC2
- Synonyms:
- 2-Chloro-6-(1-pyrrolidinyl)pyrazine
- 2-Chloro-6-pyrrolidin pyrazine
- 2-chloro-6-(1H-pyrazol-1-yl)pyrazine
- Pyrazine, 2-chloro-6-(1-pyrrolidinyl)-
- 2-Chloro-6-(pyrrolidin-1-yl)pyrazine

2-Chloro-6-(pyrrolidin-1-yl)pyrazine
Ref: 54-OR59394
1g | 161.00 € | ||
5g | 511.00 € |

Ref: 10-F067407
1g | To inquire | ||
5g | To inquire |

2-Chloro-6-(pyrrolidin-1-yl)pyrazine
Ref: 3D-AQB33930
2500mg | 454.00 € |