CAS 1000339-34-3
:1-(4-Bromophenyl)-α,α-dimethyl-1H-1,2,3-triazole-4-methanol
Description:
1-(4-Bromophenyl)-α,α-dimethyl-1H-1,2,3-triazole-4-methanol is a chemical compound characterized by its unique triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. The presence of the 4-bromophenyl group contributes to its aromatic properties and may influence its reactivity and solubility. The α,α-dimethyl substitution indicates that there are two methyl groups attached to the alpha carbon of the triazole, which can affect the steric hindrance and overall molecular conformation. The methanol functional group suggests that the compound may exhibit alcohol-like properties, including potential hydrogen bonding capabilities. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and utility in synthesizing other chemical entities. Its specific physical and chemical properties, such as melting point, boiling point, and solubility, would need to be determined experimentally or sourced from reliable databases for practical applications.
Formula:C11H12BrN3O
InChI:InChI=1S/C11H12BrN3O/c1-11(2,16)10-7-15(14-13-10)9-5-3-8(12)4-6-9/h3-7,16H,1-2H3
InChI key:InChIKey=RSIHPLASTHLNBG-UHFFFAOYSA-N
SMILES:C(C)(C)(O)C1=CN(N=N1)C2=CC=C(Br)C=C2
Synonyms:- 2-[1-(4-Bromophenyl)triazol-4-yl]propan-2-ol
- 1H-1,2,3-Triazole-4-methanol, 1-(4-bromophenyl)-α,α-dimethyl-
- 2-[1-(4-Bromophenyl)-1H-1,2,3-triazol-4-yl]propan-2-ol
- 1-(4-Bromophenyl)-α,α-dimethyl-1H-1,2,3-triazole-4-methanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
2-(1-(4-Bromophenyl)-1H-1,2,3-triazol-4-yl)propan-2-ol
CAS:Formula:C11H12BrN3OColor and Shape:SolidMolecular weight:282.13652-(1-(4-Bromophenyl)-1H-1,2,3-triazol-4-yl)propan-2-ol
CAS:Controlled ProductApplications 2-(1-(4-Bromophenyl)-1H-1,2,3-triazol-4-yl)propan-2-ol
Formula:C11H12BrN3OColor and Shape:NeatMolecular weight:282.14


