CAS 1000339-36-5
:N-Ethyl-N-[(4-methoxyphenyl)methyl]benzenesulfonamide
Description:
N-Ethyl-N-[(4-methoxyphenyl)methyl]benzenesulfonamide is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. This compound features an ethyl group and a 4-methoxyphenyl group attached to a benzenesulfonamide core, contributing to its unique chemical properties. The presence of the methoxy group enhances its lipophilicity, potentially influencing its biological activity and solubility. The sulfonamide moiety is often associated with various pharmacological activities, including antimicrobial effects. In terms of physical properties, sulfonamides typically exhibit moderate melting points and solubility in polar solvents. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. However, specific data regarding its toxicity, stability, and reactivity would require further investigation through experimental studies. Overall, N-Ethyl-N-[(4-methoxyphenyl)methyl]benzenesulfonamide represents a class of compounds with significant interest in both synthetic and medicinal chemistry.
Formula:C16H19NO3S
InChI:InChI=1S/C16H19NO3S/c1-3-17(13-14-9-11-15(20-2)12-10-14)21(18,19)16-7-5-4-6-8-16/h4-12H,3,13H2,1-2H3
InChI key:InChIKey=FPJRJXFBGCSTSH-UHFFFAOYSA-N
SMILES:S(N(CC1=CC=C(OC)C=C1)CC)(=O)(=O)C2=CC=CC=C2
Synonyms:- N-Ethyl-N-[(4-methoxyphenyl)methyl]benzenesulfonamide
- Benzenesulfonamide, N-ethyl-N-[(4-methoxyphenyl)methyl]-
- N-Ethyl-N-(4-methoxybenzyl)benzenesulphonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
N-Ethyl-N-(4-methoxybenzyl)benzenesulphonamide
CAS:N-Ethyl-N-(4-methoxybenzyl)benzenesulphonamide
Molecular weight:305.39g/mol

