CAS 1000339-51-4
:3-Fluoro-2-nitrobenzoic acid
Description:
3-Fluoro-2-nitrobenzoic acid is an aromatic compound characterized by the presence of both a nitro group and a fluorine atom on a benzoic acid framework. The nitro group (-NO2) is a strong electron-withdrawing group, which influences the reactivity and acidity of the compound, making it more acidic compared to benzoic acid. The fluorine atom, being highly electronegative, also contributes to the compound's overall polarity and can affect its solubility in various solvents. This compound typically appears as a solid at room temperature and is often used in organic synthesis and pharmaceutical applications due to its functional groups, which can participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions. Additionally, the presence of both the nitro and fluoro groups can enhance the compound's biological activity, making it of interest in medicinal chemistry. Safety precautions should be taken when handling this substance, as both nitro and fluoro compounds can pose health risks.
Formula:C7H4FNO4
InChI:InChI=1S/C7H4FNO4/c8-5-3-1-2-4(7(10)11)6(5)9(12)13/h1-3H,(H,10,11)
SMILES:c1cc(c(c(c1)F)N(=O)=O)C(=O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Fluoro-2-nitrobenzoic acid
CAS:3-Fluoro-2-nitrobenzoic acidFormula:C7H4FNO4Purity:98%Color and Shape:Off-white Solid-PowderMolecular weight:185.10936Benzoic acid, 3-fluoro-2-nitro-
CAS:Formula:C7H4FNO4Purity:95%Color and Shape:SolidMolecular weight:185.10943-Fluoro-2-nitrobenzoic acid
CAS:Formula:C7H4FNO4Purity:95%Color and Shape:SolidMolecular weight:185.113-Fluoro-2-nitrobenzoic acid
CAS:3-Fluoro-2-nitrobenzoic acid is an anhydrous nitrating agent that reacts with 5-fluoro-2-nitrobenzoic acid to produce 3,5-difluoronitrobenzene. This reaction mixture is introduced into a reaction vessel and heated in the presence of sulfuric acid. 3-Fluoro-2-nitrobenzoic acid is used in the production of dyes and pharmaceuticals.Formula:C7H4FNO4Purity:Min. 95%Color and Shape:PowderMolecular weight:185.11 g/mol



