CAS 1000339-55-8: 3-Methyl-5-(trifluoromethoxy)benzaldehyde
Description:3-Methyl-5-(trifluoromethoxy)benzaldehyde is an aromatic aldehyde characterized by the presence of a methyl group and a trifluoromethoxy group attached to a benzene ring. This compound features a benzaldehyde functional group, which is known for its reactivity in various organic synthesis reactions, particularly in nucleophilic additions and condensation reactions. The trifluoromethoxy group enhances the compound's electrophilicity due to the strong electron-withdrawing nature of the trifluoromethyl moiety, which can influence the reactivity and stability of the compound. Additionally, the presence of fluorine atoms can impart unique physical properties, such as increased lipophilicity and altered boiling and melting points compared to non-fluorinated analogs. 3-Methyl-5-(trifluoromethoxy)benzaldehyde may be utilized in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals, making it a valuable intermediate in organic chemistry. Its specific applications and behavior in reactions can vary based on the surrounding chemical environment and conditions.
Formula:C9H7F3O2
InChI:InChI=1S/C9H7F3O2/c1-6-2-7(5-13)4-8(3-6)14-9(10,11)12/h2-5H,1H3
InChI key:InChIKey=LAGVGNCAIJDRHK-UHFFFAOYSA-N
SMILES:O=CC1=CC(OC(F)(F)F)=CC(=C1)C
- Synonyms:
- Benzaldehyde, 3-methyl-5-(trifluoromethoxy)-
- 3-Methyl-5-(trifluoromethoxy)benzaldehyde
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Benzaldehyde, 3-methyl-5-(trifluoromethoxy)- REF: IN-DA0000C7CAS: 1000339-55-8 | 97% | 83.00 €~131.00 € | Thu 06 Mar 25 |
![]() | 3-Methyl-5-(trifluoromethoxy)benzaldehyde REF: 54-PC3602CAS: 1000339-55-8 | tech | 42.00 €~198.00 € | Fri 07 Mar 25 |
![]() | 3-Methyl-5-(trifluoromethoxy)benzaldehyde REF: 10-F334732CAS: 1000339-55-8 | 95.0% | - - - | Discontinued product |
![]() | Benzaldehyde, 3-methyl-5-(trifluoromethoxy)- REF: 3D-AQB33955CAS: 1000339-55-8 | Min. 95% | - - - | Discontinued product |

Benzaldehyde, 3-methyl-5-(trifluoromethoxy)-
Ref: IN-DA0000C7
1g | 131.00 € | ||
100mg | 83.00 € | ||
250mg | 105.00 € | ||
500mg | 101.00 € |

3-Methyl-5-(trifluoromethoxy)benzaldehyde
Ref: 54-PC3602
1g | 84.00 € | ||
5g | 198.00 € | ||
250mg | 42.00 € |

3-Methyl-5-(trifluoromethoxy)benzaldehyde
Ref: 10-F334732
250mg | Discontinued | Request information |

Benzaldehyde, 3-methyl-5-(trifluoromethoxy)-
Ref: 3D-AQB33955
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
500mg | Discontinued | Request information |