CymitQuimica logo

CAS 1000339-70-7

:

1-[4-Fluoro-2-(methylsulfonyl)phenyl]-4-methylpiperazine

Description:
1-[4-Fluoro-2-(methylsulfonyl)phenyl]-4-methylpiperazine is a chemical compound characterized by its unique molecular structure, which includes a piperazine ring substituted with a fluorophenyl group and a methylsulfonyl moiety. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of the sulfonyl group, which can enhance its interaction with water. The fluorine atom contributes to its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The piperazine ring is known for its role in various biological activities, often serving as a scaffold in drug design. Additionally, the presence of the methylsulfonyl group can enhance the compound's metabolic stability and influence its pharmacokinetic properties. Overall, this compound's characteristics make it a subject of interest in medicinal chemistry, particularly in the development of therapeutic agents targeting specific biological pathways.
Formula:C12H17FN2O2S
InChI:InChI=1S/C12H17FN2O2S/c1-14-5-7-15(8-6-14)11-4-3-10(13)9-12(11)18(2,16)17/h3-4,9H,5-8H2,1-2H3
InChI key:InChIKey=QURSCNLXCVCJTM-UHFFFAOYSA-N
SMILES:S(C)(=O)(=O)C1=C(C=CC(F)=C1)N2CCN(C)CC2
Synonyms:
  • 1-[4-Fluoro-2-(methylsulfonyl)phenyl]-4-methylpiperazine
  • Piperazine, 1-[4-fluoro-2-(methylsulfonyl)phenyl]-4-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.