CymitQuimica logo

CAS 1000339-71-8

:

3-[4-Fluoro-2-(methylsulfonyl)phenoxy]benzoic acid

Description:
3-[4-Fluoro-2-(methylsulfonyl)phenoxy]benzoic acid, with the CAS number 1000339-71-8, is a chemical compound characterized by its complex structure, which includes a benzoic acid moiety and a phenoxy group substituted with a fluorine atom and a methylsulfonyl group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups. The fluorine atom can enhance lipophilicity and influence biological activity, while the methylsulfonyl group may contribute to its polar characteristics. As a benzoic acid derivative, it may exhibit acidic properties, allowing it to participate in various chemical reactions, including esterification and salt formation. The compound's unique structure suggests potential applications in pharmaceuticals or agrochemicals, where such modifications can enhance efficacy or selectivity. However, specific characteristics such as melting point, boiling point, and spectral data would require empirical measurement or literature reference for precise values.
Formula:C14H11FO5S
InChI:InChI=1S/C14H11FO5S/c1-21(18,19)13-8-10(15)5-6-12(13)20-11-4-2-3-9(7-11)14(16)17/h2-8H,1H3,(H,16,17)
InChI key:InChIKey=VCLVEORXSHEWDT-UHFFFAOYSA-N
SMILES:S(C)(=O)(=O)C1=C(OC2=CC(C(O)=O)=CC=C2)C=CC(F)=C1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.