Product correctly added to cart.

3-[4-Fluoro-2-(methylsulfonyl)phenoxy]benzoic acid

CAS 1000339-71-8: 3-[4-Fluoro-2-(methylsulfonyl)phenoxy]benzoic acid

Description:3-[4-Fluoro-2-(methylsulfonyl)phenoxy]benzoic acid, with the CAS number 1000339-71-8, is a chemical compound characterized by its complex structure, which includes a benzoic acid moiety and a phenoxy group substituted with a fluorine atom and a methylsulfonyl group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups. The fluorine atom can enhance lipophilicity and influence biological activity, while the methylsulfonyl group may contribute to its polar characteristics. As a benzoic acid derivative, it may exhibit acidic properties, allowing it to participate in various chemical reactions, including esterification and salt formation. The compound's unique structure suggests potential applications in pharmaceuticals or agrochemicals, where such modifications can enhance efficacy or selectivity. However, specific characteristics such as melting point, boiling point, and spectral data would require empirical measurement or literature reference for precise values.

Formula:C14H11FO5S

InChI:InChI=1S/C14H11FO5S/c1-21(18,19)13-8-10(15)5-6-12(13)20-11-4-2-3-9(7-11)14(16)17/h2-8H,1H3,(H,16,17)

InChI key:InChIKey=VCLVEORXSHEWDT-UHFFFAOYSA-N

SMILES:O=C(O)C=1C=CC=C(OC2=CC=C(F)C=C2S(=O)(=O)C)C1

Sort by


See more categories

This search does not contain any category.

Found 3 products.

discount label

Ref: 54-PC7484

1g213.00 €
Estimated delivery in United States, on Thursday 20 Mar 2025
discount label

3-[(4-Fluoro-4-methylsulfonyl)phenoxy]benzoic acid

CAS:1000339-71-8

Ref: 3D-AQB33971

1gDiscontinuedRequest information
5gDiscontinuedRequest information
10gDiscontinuedRequest information
250mgDiscontinuedRequest information
500mgDiscontinuedRequest information
Discontinued product
Welcome to CymitQuimica!We use cookies to enhance your visit. We do not include advertising.

Please see our Cookies Policy for more details or adjust your preferences in "Settings".